C18H15BrClF2N3O3 — CID 146458658
7-bromo-N-[4-[chloro(difluoro)methoxy]phenyl]-2-(2-hydroxyethyl)-1-methylbenzimidazole-5-carboxamide (PubChem CID 146458658) has the molecular formula C18H15BrClF2N3O3 and a molecular weight of 474.69 g/mol. Its IUPAC name is 7-bromo-N-[4-[chloro(difluoro)methoxy]phenyl]-2-(2-hydroxyethyl)-1-methylbenzimidazole-5-carboxamide.
| Compound Name | 7-bromo-N-[4-[chloro(difluoro)methoxy]phenyl]-2-(2-hydroxyethyl)-1-methylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 146458658 |
| Molecular Formula | C18H15BrClF2N3O3 |
| Molecular Weight | 474.69 g/mol |
| Exact Mass | 473.00 |
| IUPAC Name | 7-bromo-N-[4-[chloro(difluoro)methoxy]phenyl]-2-(2-hydroxyethyl)-1-methylbenzimidazole-5-carboxamide |
| SMILES | Cn1c(CCO)nc2cc(C(=O)Nc3ccc(OC(F)(F)Cl)cc3)cc(Br)c21 |
| InChI | InChI=1S/C18H15BrClF2N3O3/c1-25-15(6-7-26)24-14-9-10(8-13(19)16(14)25)17(27)23-11-2-4-12(5-3-11)28-18(20,21)22/h2-5,8-9,26H,6-7H2,1H3,(H,23,27) |
| InChIKey | SDXXTEWQRIFTHN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.69 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|