C20H21BrClF2N3O4 — CID 146458731
3-bromo-N-[4-[chloro(difluoro)methoxy]phenyl]-5-(2-hydroxypropanoylamino)-4-(propan-2-ylamino)benzamide (PubChem CID 146458731) has the molecular formula C20H21BrClF2N3O4 and a molecular weight of 520.76 g/mol. Its IUPAC name is 3-bromo-N-[4-[chloro(difluoro)methoxy]phenyl]-5-(2-hydroxypropanoylamino)-4-(propan-2-ylamino)benzamide.
| Compound Name | 3-bromo-N-[4-[chloro(difluoro)methoxy]phenyl]-5-(2-hydroxypropanoylamino)-4-(propan-2-ylamino)benzamide |
|---|---|
| PubChem CID | 146458731 |
| Molecular Formula | C20H21BrClF2N3O4 |
| Molecular Weight | 520.76 g/mol |
| Exact Mass | 519.04 |
| IUPAC Name | 3-bromo-N-[4-[chloro(difluoro)methoxy]phenyl]-5-(2-hydroxypropanoylamino)-4-(propan-2-ylamino)benzamide |
| SMILES | CC(C)Nc1c(Br)cc(C(=O)Nc2ccc(OC(F)(F)Cl)cc2)cc1NC(=O)C(C)O |
| InChI | InChI=1S/C20H21BrClF2N3O4/c1-10(2)25-17-15(21)8-12(9-16(17)27-18(29)11(3)28)19(30)26-13-4-6-14(7-5-13)31-20(22,23)24/h4-11,25,28H,1-3H3,(H,26,30)(H,27,29) |
| InChIKey | ZOHDUXVTXOSBST-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.76 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|