C15H13ClF2N2O2 — CID 145388893
N-[4-[chloro(difluoro)methoxy]phenyl]-5,6-dimethylpyridine-3-carboxamide (PubChem CID 145388893) has the molecular formula C15H13ClF2N2O2 and a molecular weight of 326.73 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-5,6-dimethylpyridine-3-carboxamide.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-5,6-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 145388893 |
| Molecular Formula | C15H13ClF2N2O2 |
| Molecular Weight | 326.73 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-5,6-dimethylpyridine-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(OC(F)(F)Cl)cc2)cnc1C |
| InChI | InChI=1S/C15H13ClF2N2O2/c1-9-7-11(8-19-10(9)2)14(21)20-12-3-5-13(6-4-12)22-15(16,17)18/h3-8H,1-2H3,(H,20,21) |
| InChIKey | FVMUXFLATDOZSP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.73 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|