C22H22ClF2N5O3 — CID 118919405
N-[4-[chloro(difluoro)methoxy]phenyl]-6-[2-hydroxyethyl(propyl)amino]-5-pyrimidin-5-ylpyridine-3-carboxamide (PubChem CID 118919405) has the molecular formula C22H22ClF2N5O3 and a molecular weight of 477.90 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-6-[2-hydroxyethyl(propyl)amino]-5-pyrimidin-5-ylpyridine-3-carboxamide.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-6-[2-hydroxyethyl(propyl)amino]-5-pyrimidin-5-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 118919405 |
| Molecular Formula | C22H22ClF2N5O3 |
| Molecular Weight | 477.90 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-6-[2-hydroxyethyl(propyl)amino]-5-pyrimidin-5-ylpyridine-3-carboxamide |
| SMILES | CCCN(CCO)c1ncc(C(=O)Nc2ccc(OC(F)(F)Cl)cc2)cc1-c1cncnc1 |
| InChI | InChI=1S/C22H22ClF2N5O3/c1-2-7-30(8-9-31)20-19(16-11-26-14-27-12-16)10-15(13-28-20)21(32)29-17-3-5-18(6-4-17)33-22(23,24)25/h3-6,10-14,31H,2,7-9H2,1H3,(H,29,32) |
| InChIKey | BQLZZNLVBSXEJF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 100.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.90 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|