C23H23ClF3N5O4 — CID 118200044
6-[[(2R)-2-aminooxy-2-methoxyethyl]-ethylamino]-N-[4-[chloro(difluoro)methoxy]phenyl]-5-(5-fluoro-3-pyridinyl)pyridine-3-carboxamide (PubChem CID 118200044) has the molecular formula C23H23ClF3N5O4 and a molecular weight of 525.92 g/mol. Its IUPAC name is 6-[[(2R)-2-aminooxy-2-methoxyethyl]-ethylamino]-N-[4-[chloro(difluoro)methoxy]phenyl]-5-(5-fluoro-3-pyridinyl)pyridine-3-carboxamide.
| Compound Name | 6-[[(2R)-2-aminooxy-2-methoxyethyl]-ethylamino]-N-[4-[chloro(difluoro)methoxy]phenyl]-5-(5-fluoro-3-pyridinyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118200044 |
| Molecular Formula | C23H23ClF3N5O4 |
| Molecular Weight | 525.92 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | 6-[[(2R)-2-aminooxy-2-methoxyethyl]-ethylamino]-N-[4-[chloro(difluoro)methoxy]phenyl]-5-(5-fluoro-3-pyridinyl)pyridine-3-carboxamide |
| SMILES | CCN(C[C@H](OC)ON)c1ncc(C(=O)Nc2ccc(OC(F)(F)Cl)cc2)cc1-c1cncc(F)c1 |
| InChI | InChI=1S/C23H23ClF3N5O4/c1-3-32(13-20(34-2)36-28)21-19(14-8-16(25)12-29-10-14)9-15(11-30-21)22(33)31-17-4-6-18(7-5-17)35-23(24,26)27/h4-12,20H,3,13,28H2,1-2H3,(H,31,33)/t20-/m1/s1 |
| InChIKey | NFGSDIQABRXZOC-HXUWFJFHSA-N |
| XLogP | 4.39 |
| TPSA | 111.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.92 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|