C25H22ClF2N5O2 — CID 118919276
N-[4-[chloro(difluoro)methoxy]phenyl]-5-(5-cyano-3-pyridinyl)-6-[(3S)-3-ethylpyrrolidin-1-yl]pyridine-3-carboxamide (PubChem CID 118919276) has the molecular formula C25H22ClF2N5O2 and a molecular weight of 497.93 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-5-(5-cyano-3-pyridinyl)-6-[(3S)-3-ethylpyrrolidin-1-yl]pyridine-3-carboxamide.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-5-(5-cyano-3-pyridinyl)-6-[(3S)-3-ethylpyrrolidin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118919276 |
| Molecular Formula | C25H22ClF2N5O2 |
| Molecular Weight | 497.93 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-5-(5-cyano-3-pyridinyl)-6-[(3S)-3-ethylpyrrolidin-1-yl]pyridine-3-carboxamide |
| SMILES | CC[C@H]1CCN(c2ncc(C(=O)Nc3ccc(OC(F)(F)Cl)cc3)cc2-c2cncc(C#N)c2)C1 |
| InChI | InChI=1S/C25H22ClF2N5O2/c1-2-16-7-8-33(15-16)23-22(18-9-17(11-29)12-30-13-18)10-19(14-31-23)24(34)32-20-3-5-21(6-4-20)35-25(26,27)28/h3-6,9-10,12-14,16H,2,7-8,15H2,1H3,(H,32,34)/t16-/m0/s1 |
| InChIKey | ILAJWNSHMXLAGD-INIZCTEOSA-N |
| XLogP | 5.67 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.93 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|