C22H18ClF2IN4O3 — CID 134288411
5-(5-chloro-3-pyridinyl)-N-[4-[difluoro(iodo)methoxy]phenyl]-6-[(3R)-3-hydroxypyrrolidin-1-yl]pyridine-3-carboxamide (PubChem CID 134288411) has the molecular formula C22H18ClF2IN4O3 and a molecular weight of 586.76 g/mol. Its IUPAC name is 5-(5-chloro-3-pyridinyl)-N-[4-[difluoro(iodo)methoxy]phenyl]-6-[(3R)-3-hydroxypyrrolidin-1-yl]pyridine-3-carboxamide.
| Compound Name | 5-(5-chloro-3-pyridinyl)-N-[4-[difluoro(iodo)methoxy]phenyl]-6-[(3R)-3-hydroxypyrrolidin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 134288411 |
| Molecular Formula | C22H18ClF2IN4O3 |
| Molecular Weight | 586.76 g/mol |
| Exact Mass | 586.01 |
| IUPAC Name | 5-(5-chloro-3-pyridinyl)-N-[4-[difluoro(iodo)methoxy]phenyl]-6-[(3R)-3-hydroxypyrrolidin-1-yl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)I)cc1)c1cnc(N2CC[C@@H](O)C2)c(-c2cncc(Cl)c2)c1 |
| InChI | InChI=1S/C22H18ClF2IN4O3/c23-15-7-13(9-27-11-15)19-8-14(10-28-20(19)30-6-5-17(31)12-30)21(32)29-16-1-3-18(4-2-16)33-22(24,25)26/h1-4,7-11,17,31H,5-6,12H2,(H,29,32)/t17-/m1/s1 |
| InChIKey | HUZSYJIUVBJGTM-QGZVFWFLSA-N |
| XLogP | 4.98 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.76 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|