C23H21ClF2N4O3 — CID 118195396
N-[4-[chloro(difluoro)methoxy]phenyl]-6-(3-hydroxypyrrolidin-1-yl)-5-(4-methyl-3-pyridinyl)pyridine-3-carboxamide (PubChem CID 118195396) has the molecular formula C23H21ClF2N4O3 and a molecular weight of 474.90 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-6-(3-hydroxypyrrolidin-1-yl)-5-(4-methyl-3-pyridinyl)pyridine-3-carboxamide.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-6-(3-hydroxypyrrolidin-1-yl)-5-(4-methyl-3-pyridinyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118195396 |
| Molecular Formula | C23H21ClF2N4O3 |
| Molecular Weight | 474.90 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-6-(3-hydroxypyrrolidin-1-yl)-5-(4-methyl-3-pyridinyl)pyridine-3-carboxamide |
| SMILES | Cc1ccncc1-c1cc(C(=O)Nc2ccc(OC(F)(F)Cl)cc2)cnc1N1CCC(O)C1 |
| InChI | InChI=1S/C23H21ClF2N4O3/c1-14-6-8-27-12-20(14)19-10-15(11-28-21(19)30-9-7-17(31)13-30)22(32)29-16-2-4-18(5-3-16)33-23(24,25)26/h2-6,8,10-12,17,31H,7,9,13H2,1H3,(H,29,32) |
| InChIKey | ZPWVAIVRLQAWBV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.90 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|