C22H19ClF2N6O5 — CID 175219459
N-[4-[chloro(difluoro)methoxy]phenyl]-6-(3-hydroxypyrrolidin-1-yl)-5-[(4-nitro-3-pyridinyl)amino]pyridine-3-carboxamide (PubChem CID 175219459) has the molecular formula C22H19ClF2N6O5 and a molecular weight of 520.88 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-6-(3-hydroxypyrrolidin-1-yl)-5-[(4-nitro-3-pyridinyl)amino]pyridine-3-carboxamide.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-6-(3-hydroxypyrrolidin-1-yl)-5-[(4-nitro-3-pyridinyl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175219459 |
| Molecular Formula | C22H19ClF2N6O5 |
| Molecular Weight | 520.88 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-6-(3-hydroxypyrrolidin-1-yl)-5-[(4-nitro-3-pyridinyl)amino]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)Cl)cc1)c1cnc(N2CCC(O)C2)c(Nc2cnccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H19ClF2N6O5/c23-22(24,25)36-16-3-1-14(2-4-16)28-21(33)13-9-17(20(27-10-13)30-8-6-15(32)12-30)29-18-11-26-7-5-19(18)31(34)35/h1-5,7,9-11,15,29,32H,6,8,12H2,(H,28,33) |
| InChIKey | HTILZVXLEMVRTK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.88 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|