C24H23ClF2N4O4 — CID 163210769
N-[4-[chloro(difluoro)methoxy]phenyl]-6-[(3R)-3-hydroxypyrrolidin-1-yl]-5-(4-methoxyanilino)pyridine-3-carboxamide (PubChem CID 163210769) has the molecular formula C24H23ClF2N4O4 and a molecular weight of 504.92 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-6-[(3R)-3-hydroxypyrrolidin-1-yl]-5-(4-methoxyanilino)pyridine-3-carboxamide.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-6-[(3R)-3-hydroxypyrrolidin-1-yl]-5-(4-methoxyanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 163210769 |
| Molecular Formula | C24H23ClF2N4O4 |
| Molecular Weight | 504.92 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-6-[(3R)-3-hydroxypyrrolidin-1-yl]-5-(4-methoxyanilino)pyridine-3-carboxamide |
| SMILES | COc1ccc(Nc2cc(C(=O)Nc3ccc(OC(F)(F)Cl)cc3)cnc2N2CC[C@@H](O)C2)cc1 |
| InChI | InChI=1S/C24H23ClF2N4O4/c1-34-19-6-2-16(3-7-19)29-21-12-15(13-28-22(21)31-11-10-18(32)14-31)23(33)30-17-4-8-20(9-5-17)35-24(25,26)27/h2-9,12-13,18,29,32H,10-11,14H2,1H3,(H,30,33)/t18-/m1/s1 |
| InChIKey | RVDQLPMZMOUPKF-GOSISDBHSA-N |
| XLogP | 4.82 |
| TPSA | 95.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.92 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|