C18H17BrClF2N3O3S — CID 145388899
5-bromo-N-[4-[chloro(difluoro)methoxy]phenyl]-6-[(3S)-3-methylsulfinylpyrrolidin-1-yl]pyridine-3-carboxamide (PubChem CID 145388899) has the molecular formula C18H17BrClF2N3O3S and a molecular weight of 508.77 g/mol. Its IUPAC name is 5-bromo-N-[4-[chloro(difluoro)methoxy]phenyl]-6-[(3S)-3-methylsulfinylpyrrolidin-1-yl]pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-[4-[chloro(difluoro)methoxy]phenyl]-6-[(3S)-3-methylsulfinylpyrrolidin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 145388899 |
| Molecular Formula | C18H17BrClF2N3O3S |
| Molecular Weight | 508.77 g/mol |
| Exact Mass | 506.98 |
| IUPAC Name | 5-bromo-N-[4-[chloro(difluoro)methoxy]phenyl]-6-[(3S)-3-methylsulfinylpyrrolidin-1-yl]pyridine-3-carboxamide |
| SMILES | CS(=O)[C@H]1CCN(c2ncc(C(=O)Nc3ccc(OC(F)(F)Cl)cc3)cc2Br)C1 |
| InChI | InChI=1S/C18H17BrClF2N3O3S/c1-29(27)14-6-7-25(10-14)16-15(19)8-11(9-23-16)17(26)24-12-2-4-13(5-3-12)28-18(20,21)22/h2-5,8-9,14H,6-7,10H2,1H3,(H,24,26)/t14-,29?/m0/s1 |
| InChIKey | TXPQOQQWIQFSMZ-XKGYJNPMSA-N |
| XLogP | 4.22 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.77 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|