C17H10BrClF3N3O2 — CID 156894881
5-bromo-N-[4-[chloro(difluoro)methoxy]phenyl]-6-(3-fluoropyrrol-1-yl)pyridine-3-carboxamide (PubChem CID 156894881) has the molecular formula C17H10BrClF3N3O2 and a molecular weight of 460.64 g/mol. Its IUPAC name is 5-bromo-N-[4-[chloro(difluoro)methoxy]phenyl]-6-(3-fluoropyrrol-1-yl)pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-[4-[chloro(difluoro)methoxy]phenyl]-6-(3-fluoropyrrol-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 156894881 |
| Molecular Formula | C17H10BrClF3N3O2 |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 458.96 |
| IUPAC Name | 5-bromo-N-[4-[chloro(difluoro)methoxy]phenyl]-6-(3-fluoropyrrol-1-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)Cl)cc1)c1cnc(-n2ccc(F)c2)c(Br)c1 |
| InChI | InChI=1S/C17H10BrClF3N3O2/c18-14-7-10(8-23-15(14)25-6-5-11(20)9-25)16(26)24-12-1-3-13(4-2-12)27-17(19,21)22/h1-9H,(H,24,26) |
| InChIKey | QYDSUDMEDSFPQW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|