C18H16ClF3N4O2S — CID 135258323
5-carbamothioyl-N-[4-[chloro(difluoro)methoxy]phenyl]-6-[(3R)-3-fluoropyrrolidin-1-yl]pyridine-3-carboxamide (PubChem CID 135258323) has the molecular formula C18H16ClF3N4O2S and a molecular weight of 444.87 g/mol. Its IUPAC name is 5-carbamothioyl-N-[4-[chloro(difluoro)methoxy]phenyl]-6-[(3R)-3-fluoropyrrolidin-1-yl]pyridine-3-carboxamide.
| Compound Name | 5-carbamothioyl-N-[4-[chloro(difluoro)methoxy]phenyl]-6-[(3R)-3-fluoropyrrolidin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 135258323 |
| Molecular Formula | C18H16ClF3N4O2S |
| Molecular Weight | 444.87 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 5-carbamothioyl-N-[4-[chloro(difluoro)methoxy]phenyl]-6-[(3R)-3-fluoropyrrolidin-1-yl]pyridine-3-carboxamide |
| SMILES | NC(=S)c1cc(C(=O)Nc2ccc(OC(F)(F)Cl)cc2)cnc1N1CC[C@@H](F)C1 |
| InChI | InChI=1S/C18H16ClF3N4O2S/c19-18(21,22)28-13-3-1-12(2-4-13)25-17(27)10-7-14(15(23)29)16(24-8-10)26-6-5-11(20)9-26/h1-4,7-8,11H,5-6,9H2,(H2,23,29)(H,25,27)/t11-/m1/s1 |
| InChIKey | HFOYCFRZSOXISE-LLVKDONJSA-N |
| XLogP | 3.68 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.87 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|