C17H16BrClF2N4O3 — CID 146186595
5-bromo-N-[4-[chloro(difluoro)methoxy]phenyl]-6-[3-(hydroxyamino)pyrrolidin-1-yl]pyridine-3-carboxamide (PubChem CID 146186595) has the molecular formula C17H16BrClF2N4O3 and a molecular weight of 477.69 g/mol. Its IUPAC name is 5-bromo-N-[4-[chloro(difluoro)methoxy]phenyl]-6-[3-(hydroxyamino)pyrrolidin-1-yl]pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-[4-[chloro(difluoro)methoxy]phenyl]-6-[3-(hydroxyamino)pyrrolidin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 146186595 |
| Molecular Formula | C17H16BrClF2N4O3 |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 476.01 |
| IUPAC Name | 5-bromo-N-[4-[chloro(difluoro)methoxy]phenyl]-6-[3-(hydroxyamino)pyrrolidin-1-yl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)Cl)cc1)c1cnc(N2CCC(NO)C2)c(Br)c1 |
| InChI | InChI=1S/C17H16BrClF2N4O3/c18-14-7-10(8-22-15(14)25-6-5-12(9-25)24-27)16(26)23-11-1-3-13(4-2-11)28-17(19,20)21/h1-4,7-8,12,24,27H,5-6,9H2,(H,23,26) |
| InChIKey | MZDPTFQYMFIAAQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|