C22H21ClF2N6O2 — CID 118198920
6-[(3R)-3-aminopiperidin-1-yl]-N-[4-[chloro(difluoro)methoxy]phenyl]-5-pyrimidin-5-ylpyridine-3-carboxamide (PubChem CID 118198920) has the molecular formula C22H21ClF2N6O2 and a molecular weight of 474.90 g/mol. Its IUPAC name is 6-[(3R)-3-aminopiperidin-1-yl]-N-[4-[chloro(difluoro)methoxy]phenyl]-5-pyrimidin-5-ylpyridine-3-carboxamide.
| Compound Name | 6-[(3R)-3-aminopiperidin-1-yl]-N-[4-[chloro(difluoro)methoxy]phenyl]-5-pyrimidin-5-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 118198920 |
| Molecular Formula | C22H21ClF2N6O2 |
| Molecular Weight | 474.90 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 6-[(3R)-3-aminopiperidin-1-yl]-N-[4-[chloro(difluoro)methoxy]phenyl]-5-pyrimidin-5-ylpyridine-3-carboxamide |
| SMILES | N[C@@H]1CCCN(c2ncc(C(=O)Nc3ccc(OC(F)(F)Cl)cc3)cc2-c2cncnc2)C1 |
| InChI | InChI=1S/C22H21ClF2N6O2/c23-22(24,25)33-18-5-3-17(4-6-18)30-21(32)14-8-19(15-9-27-13-28-10-15)20(29-11-14)31-7-1-2-16(26)12-31/h3-6,8-11,13,16H,1-2,7,12,26H2,(H,30,32)/t16-/m1/s1 |
| InChIKey | XHKPYWKJUUQQMQ-MRXNPFEDSA-N |
| XLogP | 3.89 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.90 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|