C20H17ClF2N6O2 — CID 149027834
N-[4-[chloro(difluoro)methoxy]phenyl]-6-pyrrolidin-1-yl-5-(1,2,4-triazin-6-yl)pyridine-3-carboxamide (PubChem CID 149027834) has the molecular formula C20H17ClF2N6O2 and a molecular weight of 446.85 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-6-pyrrolidin-1-yl-5-(1,2,4-triazin-6-yl)pyridine-3-carboxamide.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-6-pyrrolidin-1-yl-5-(1,2,4-triazin-6-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 149027834 |
| Molecular Formula | C20H17ClF2N6O2 |
| Molecular Weight | 446.85 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-6-pyrrolidin-1-yl-5-(1,2,4-triazin-6-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)Cl)cc1)c1cnc(N2CCCC2)c(-c2cncnn2)c1 |
| InChI | InChI=1S/C20H17ClF2N6O2/c21-20(22,23)31-15-5-3-14(4-6-15)27-19(30)13-9-16(17-11-24-12-26-28-17)18(25-10-13)29-7-1-2-8-29/h3-6,9-12H,1-2,7-8H2,(H,27,30) |
| InChIKey | QETGLYVSMHFXEL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.85 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|