C22H18ClF2N5O2 — CID 123610230
N-[4-[chloro(difluoro)methoxy]phenyl]-5-(5-cyano-1H-pyrrol-2-yl)-6-pyrrolidin-1-ylpyridine-3-carboxamide (PubChem CID 123610230) has the molecular formula C22H18ClF2N5O2 and a molecular weight of 457.87 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-5-(5-cyano-1H-pyrrol-2-yl)-6-pyrrolidin-1-ylpyridine-3-carboxamide.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-5-(5-cyano-1H-pyrrol-2-yl)-6-pyrrolidin-1-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 123610230 |
| Molecular Formula | C22H18ClF2N5O2 |
| Molecular Weight | 457.87 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-5-(5-cyano-1H-pyrrol-2-yl)-6-pyrrolidin-1-ylpyridine-3-carboxamide |
| SMILES | N#Cc1ccc(-c2cc(C(=O)Nc3ccc(OC(F)(F)Cl)cc3)cnc2N2CCCC2)[nH]1 |
| InChI | InChI=1S/C22H18ClF2N5O2/c23-22(24,25)32-17-6-3-15(4-7-17)29-21(31)14-11-18(19-8-5-16(12-26)28-19)20(27-13-14)30-9-1-2-10-30/h3-8,11,13,28H,1-2,9-10H2,(H,29,31) |
| InChIKey | RBDKVZKNAVZRHH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.87 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|