C22H17F5N4O2 — CID 123948489
5-(2,6-difluoro-4-pyridinyl)-6-pyrrolidin-1-yl-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide (PubChem CID 123948489) has the molecular formula C22H17F5N4O2 and a molecular weight of 464.39 g/mol. Its IUPAC name is 5-(2,6-difluoro-4-pyridinyl)-6-pyrrolidin-1-yl-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide.
| Compound Name | 5-(2,6-difluoro-4-pyridinyl)-6-pyrrolidin-1-yl-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 123948489 |
| Molecular Formula | C22H17F5N4O2 |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 5-(2,6-difluoro-4-pyridinyl)-6-pyrrolidin-1-yl-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)c1cnc(N2CCCC2)c(-c2cc(F)nc(F)c2)c1 |
| InChI | InChI=1S/C22H17F5N4O2/c23-18-10-13(11-19(24)30-18)17-9-14(12-28-20(17)31-7-1-2-8-31)21(32)29-15-3-5-16(6-4-15)33-22(25,26)27/h3-6,9-12H,1-2,7-8H2,(H,29,32) |
| InChIKey | NMRZTTVDKKHRBR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|