C25H27BrClF2N3O4S — CID 165163968
5-bromo-N-[4-[chloro(difluoro)methoxy]phenyl]-3-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-propan-2-yl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indole-7-carboxamide (PubChem CID 165163968) has the molecular formula C25H27BrClF2N3O4S and a molecular weight of 618.93 g/mol. Its IUPAC name is 5-bromo-N-[4-[chloro(difluoro)methoxy]phenyl]-3-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-propan-2-yl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indole-7-carboxamide.
| Compound Name | 5-bromo-N-[4-[chloro(difluoro)methoxy]phenyl]-3-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-propan-2-yl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indole-7-carboxamide |
|---|---|
| PubChem CID | 165163968 |
| Molecular Formula | C25H27BrClF2N3O4S |
| Molecular Weight | 618.93 g/mol |
| Exact Mass | 617.06 |
| IUPAC Name | 5-bromo-N-[4-[chloro(difluoro)methoxy]phenyl]-3-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-propan-2-yl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indole-7-carboxamide |
| SMILES | CC(C)N1c2c(Br)cc(C(=O)Nc3ccc(OC(F)(F)Cl)cc3)cc2C2CCC(N3CCCS3(=O)=O)C21 |
| InChI | InChI=1S/C25H27BrClF2N3O4S/c1-14(2)32-22-19(18-8-9-21(23(18)32)31-10-3-11-37(31,34)35)12-15(13-20(22)26)24(33)30-16-4-6-17(7-5-16)36-25(27,28)29/h4-7,12-14,18,21,23H,3,8-11H2,1-2H3,(H,30,33) |
| InChIKey | JMFBCBGRFYIBLV-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.93 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|