C26H25ClF2N4O3 — CID 146458670
N-[4-[chloro(difluoro)methoxy]phenyl]-7-[(4-methoxyphenyl)methylamino]-1-propan-2-ylbenzimidazole-5-carboxamide (PubChem CID 146458670) has the molecular formula C26H25ClF2N4O3 and a molecular weight of 514.96 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-7-[(4-methoxyphenyl)methylamino]-1-propan-2-ylbenzimidazole-5-carboxamide.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-7-[(4-methoxyphenyl)methylamino]-1-propan-2-ylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 146458670 |
| Molecular Formula | C26H25ClF2N4O3 |
| Molecular Weight | 514.96 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-7-[(4-methoxyphenyl)methylamino]-1-propan-2-ylbenzimidazole-5-carboxamide |
| SMILES | COc1ccc(CNc2cc(C(=O)Nc3ccc(OC(F)(F)Cl)cc3)cc3ncn(C(C)C)c23)cc1 |
| InChI | InChI=1S/C26H25ClF2N4O3/c1-16(2)33-15-31-23-13-18(25(34)32-19-6-10-21(11-7-19)36-26(27,28)29)12-22(24(23)33)30-14-17-4-8-20(35-3)9-5-17/h4-13,15-16,30H,14H2,1-3H3,(H,32,34) |
| InChIKey | NYMOERNQPUCMBF-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.96 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|