C24H20ClF2N5O2 — CID 146508269
N-[4-[chloro(difluoro)methoxy]phenyl]-1-[(1S)-1-cyclopropylethyl]-7-pyrimidin-5-ylbenzimidazole-5-carboxamide (PubChem CID 146508269) has the molecular formula C24H20ClF2N5O2 and a molecular weight of 483.91 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-1-[(1S)-1-cyclopropylethyl]-7-pyrimidin-5-ylbenzimidazole-5-carboxamide.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-1-[(1S)-1-cyclopropylethyl]-7-pyrimidin-5-ylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 146508269 |
| Molecular Formula | C24H20ClF2N5O2 |
| Molecular Weight | 483.91 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-1-[(1S)-1-cyclopropylethyl]-7-pyrimidin-5-ylbenzimidazole-5-carboxamide |
| SMILES | C[C@@H](C1CC1)n1cnc2cc(C(=O)Nc3ccc(OC(F)(F)Cl)cc3)cc(-c3cncnc3)c21 |
| InChI | InChI=1S/C24H20ClF2N5O2/c1-14(15-2-3-15)32-13-30-21-9-16(8-20(22(21)32)17-10-28-12-29-11-17)23(33)31-18-4-6-19(7-5-18)34-24(25,26)27/h4-15H,2-3H2,1H3,(H,31,33)/t14-/m0/s1 |
| InChIKey | AKQQEJPWRQCYSX-AWEZNQCLSA-N |
| XLogP | 5.88 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.91 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|