C23H14ClF2N5O4S — CID 175124233
N-[4-[chloro(difluoro)methoxy]phenyl]-1-(1,1-dioxothiophen-3-yl)-7-pyrimidin-5-ylbenzimidazole-5-carboxamide (PubChem CID 175124233) has the molecular formula C23H14ClF2N5O4S and a molecular weight of 529.91 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-1-(1,1-dioxothiophen-3-yl)-7-pyrimidin-5-ylbenzimidazole-5-carboxamide.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-1-(1,1-dioxothiophen-3-yl)-7-pyrimidin-5-ylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 175124233 |
| Molecular Formula | C23H14ClF2N5O4S |
| Molecular Weight | 529.91 g/mol |
| Exact Mass | 529.04 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-1-(1,1-dioxothiophen-3-yl)-7-pyrimidin-5-ylbenzimidazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)Cl)cc1)c1cc(-c2cncnc2)c2c(c1)ncn2C1=CS(=O)(=O)C=C1 |
| InChI | InChI=1S/C23H14ClF2N5O4S/c24-23(25,26)35-18-3-1-16(2-4-18)30-22(32)14-7-19(15-9-27-12-28-10-15)21-20(8-14)29-13-31(21)17-5-6-36(33,34)11-17/h1-13H,(H,30,32) |
| InChIKey | UFNHJWACSWEKFV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.91 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|