C23H18ClF2N5O3 — CID 146508270
N-[4-[chloro(difluoro)methoxy]phenyl]-1-[1-(hydroxymethyl)cyclopropyl]-7-pyrimidin-5-ylbenzimidazole-5-carboxamide (PubChem CID 146508270) has the molecular formula C23H18ClF2N5O3 and a molecular weight of 485.88 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-1-[1-(hydroxymethyl)cyclopropyl]-7-pyrimidin-5-ylbenzimidazole-5-carboxamide.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-1-[1-(hydroxymethyl)cyclopropyl]-7-pyrimidin-5-ylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 146508270 |
| Molecular Formula | C23H18ClF2N5O3 |
| Molecular Weight | 485.88 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-1-[1-(hydroxymethyl)cyclopropyl]-7-pyrimidin-5-ylbenzimidazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)Cl)cc1)c1cc(-c2cncnc2)c2c(c1)ncn2C1(CO)CC1 |
| InChI | InChI=1S/C23H18ClF2N5O3/c24-23(25,26)34-17-3-1-16(2-4-17)30-21(33)14-7-18(15-9-27-12-28-10-15)20-19(8-14)29-13-31(20)22(11-32)5-6-22/h1-4,7-10,12-13,32H,5-6,11H2,(H,30,33) |
| InChIKey | YCKLWWIKAONNMI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.88 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|