C25H23ClF2N4O3 — CID 166004789
N-[4-[chloro(difluoro)methoxy]phenyl]-3,3-dimethyl-2-oxo-1-propan-2-yl-7-pyrimidin-5-ylindole-5-carboxamide (PubChem CID 166004789) has the molecular formula C25H23ClF2N4O3 and a molecular weight of 500.93 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-3,3-dimethyl-2-oxo-1-propan-2-yl-7-pyrimidin-5-ylindole-5-carboxamide.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-3,3-dimethyl-2-oxo-1-propan-2-yl-7-pyrimidin-5-ylindole-5-carboxamide |
|---|---|
| PubChem CID | 166004789 |
| Molecular Formula | C25H23ClF2N4O3 |
| Molecular Weight | 500.93 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-3,3-dimethyl-2-oxo-1-propan-2-yl-7-pyrimidin-5-ylindole-5-carboxamide |
| SMILES | CC(C)N1C(=O)C(C)(C)c2cc(C(=O)Nc3ccc(OC(F)(F)Cl)cc3)cc(-c3cncnc3)c21 |
| InChI | InChI=1S/C25H23ClF2N4O3/c1-14(2)32-21-19(16-11-29-13-30-12-16)9-15(10-20(21)24(3,4)23(32)34)22(33)31-17-5-7-18(8-6-17)35-25(26,27)28/h5-14H,1-4H3,(H,31,33) |
| InChIKey | OMJPDWKYLHFFMN-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.93 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|