C19H16ClF2NO3 — CID 604624
N-[4-[chloro(difluoro)methoxy]phenyl]-4-(3-hydroxy-3-methylbut-1-ynyl)benzamide (PubChem CID 604624) has the molecular formula C19H16ClF2NO3 and a molecular weight of 379.79 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-4-(3-hydroxy-3-methylbut-1-ynyl)benzamide.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-4-(3-hydroxy-3-methylbut-1-ynyl)benzamide |
|---|---|
| PubChem CID | 604624 |
| Molecular Formula | C19H16ClF2NO3 |
| Molecular Weight | 379.79 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-4-(3-hydroxy-3-methylbut-1-ynyl)benzamide |
| SMILES | CC(C)(O)C#Cc1ccc(C(=O)Nc2ccc(OC(F)(F)Cl)cc2)cc1 |
| InChI | InChI=1S/C19H16ClF2NO3/c1-18(2,25)12-11-13-3-5-14(6-4-13)17(24)23-15-7-9-16(10-8-15)26-19(20,21)22/h3-10,25H,1-2H3,(H,23,24) |
| InChIKey | BKCOPLUKZDDUIR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.79 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|