C30H29N3O4 — CID 59571975
5-amino-1-N,3-N-bis[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]benzene-1,3-dicarboxamide (PubChem CID 59571975) has the molecular formula C30H29N3O4 and a molecular weight of 495.58 g/mol. Its IUPAC name is 5-amino-1-N,3-N-bis[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]benzene-1,3-dicarboxamide.
| Compound Name | 5-amino-1-N,3-N-bis[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 59571975 |
| Molecular Formula | C30H29N3O4 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | 5-amino-1-N,3-N-bis[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]benzene-1,3-dicarboxamide |
| SMILES | CC(C)(O)C#Cc1ccc(NC(=O)c2cc(N)cc(C(=O)Nc3ccc(C#CC(C)(C)O)cc3)c2)cc1 |
| InChI | InChI=1S/C30H29N3O4/c1-29(2,36)15-13-20-5-9-25(10-6-20)32-27(34)22-17-23(19-24(31)18-22)28(35)33-26-11-7-21(8-12-26)14-16-30(3,4)37/h5-12,17-19,36-37H,31H2,1-4H3,(H,32,34)(H,33,35) |
| InChIKey | DJTWBQJJNCMOEQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|