C26H32N2O3 — CID 11718721
2-(diethylamino)ethyl 4-[[4-(3,3-dimethylbut-1-ynyl)benzoyl]amino]benzoate (PubChem CID 11718721) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-[[4-(3,3-dimethylbut-1-ynyl)benzoyl]amino]benzoate.
| Compound Name | 2-(diethylamino)ethyl 4-[[4-(3,3-dimethylbut-1-ynyl)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 11718721 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 2-(diethylamino)ethyl 4-[[4-(3,3-dimethylbut-1-ynyl)benzoyl]amino]benzoate |
| SMILES | CCN(CC)CCOC(=O)c1ccc(NC(=O)c2ccc(C#CC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H32N2O3/c1-6-28(7-2)18-19-31-25(30)22-12-14-23(15-13-22)27-24(29)21-10-8-20(9-11-21)16-17-26(3,4)5/h8-15H,6-7,18-19H2,1-5H3,(H,27,29) |
| InChIKey | HNMKWRUKQCCKNR-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|