C25H33N3O6S — CID 4153056
2-(diethylamino)ethyl 4-[(4-methyl-3-morpholin-4-ylsulfonylbenzoyl)amino]benzoate (PubChem CID 4153056) has the molecular formula C25H33N3O6S and a molecular weight of 503.62 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-[(4-methyl-3-morpholin-4-ylsulfonylbenzoyl)amino]benzoate.
| Compound Name | 2-(diethylamino)ethyl 4-[(4-methyl-3-morpholin-4-ylsulfonylbenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 4153056 |
| Molecular Formula | C25H33N3O6S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 2-(diethylamino)ethyl 4-[(4-methyl-3-morpholin-4-ylsulfonylbenzoyl)amino]benzoate |
| SMILES | CCN(CC)CCOC(=O)c1ccc(NC(=O)c2ccc(C)c(S(=O)(=O)N3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C25H33N3O6S/c1-4-27(5-2)12-17-34-25(30)20-8-10-22(11-9-20)26-24(29)21-7-6-19(3)23(18-21)35(31,32)28-13-15-33-16-14-28/h6-11,18H,4-5,12-17H2,1-3H3,(H,26,29) |
| InChIKey | LTNUASSKFHPIEG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |