C17H22N4O3S — CID 21008218
2-(diethylamino)ethyl 4-[(4-methylthiadiazole-5-carbonyl)amino]benzoate (PubChem CID 21008218) has the molecular formula C17H22N4O3S and a molecular weight of 362.46 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-[(4-methylthiadiazole-5-carbonyl)amino]benzoate.
| Compound Name | 2-(diethylamino)ethyl 4-[(4-methylthiadiazole-5-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 21008218 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2-(diethylamino)ethyl 4-[(4-methylthiadiazole-5-carbonyl)amino]benzoate |
| SMILES | CCN(CC)CCOC(=O)c1ccc(NC(=O)c2snnc2C)cc1 |
| InChI | InChI=1S/C17H22N4O3S/c1-4-21(5-2)10-11-24-17(23)13-6-8-14(9-7-13)18-16(22)15-12(3)19-20-25-15/h6-9H,4-5,10-11H2,1-3H3,(H,18,22) |
| InChIKey | OBTGSDJBPSWRLH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |