C17H28ClNO2 — CID 2929493
2-(diethylamino)ethyl 4-tert-butylbenzoate;hydrochloride (PubChem CID 2929493) has the molecular formula C17H28ClNO2 and a molecular weight of 313.87 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-tert-butylbenzoate;hydrochloride.
| Compound Name | 2-(diethylamino)ethyl 4-tert-butylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 2929493 |
| Molecular Formula | C17H28ClNO2 |
| Molecular Weight | 313.87 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 2-(diethylamino)ethyl 4-tert-butylbenzoate;hydrochloride |
| SMILES | CCN(CC)CCOC(=O)c1ccc(C(C)(C)C)cc1.Cl |
| InChI | InChI=1S/C17H27NO2.ClH/c1-6-18(7-2)12-13-20-16(19)14-8-10-15(11-9-14)17(3,4)5;/h8-11H,6-7,12-13H2,1-5H3;1H |
| InChIKey | IQURLTAHOIPNST-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.87 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |