C13H20BF4N2O2- — CID 138319577
2-(diethylamino)ethyl 4-aminobenzoate tetrafluoroborate (PubChem CID 138319577) has the molecular formula C13H20BF4N2O2- and a molecular weight of 323.12 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-aminobenzoate tetrafluoroborate.
| Compound Name | 2-(diethylamino)ethyl 4-aminobenzoate tetrafluoroborate |
|---|---|
| PubChem CID | 138319577 |
| Molecular Formula | C13H20BF4N2O2- |
| Molecular Weight | 323.12 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 2-(diethylamino)ethyl 4-aminobenzoate tetrafluoroborate |
| SMILES | CCN(CC)CCOC(=O)c1ccc(N)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C13H20N2O2.BF4/c1-3-15(4-2)9-10-17-13(16)11-5-7-12(14)8-6-11;2-1(3,4)5/h5-8H,3-4,9-10,14H2,1-2H3;/q;-1 |
| InChIKey | RWXNVFPCMSQELC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.12 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|