C22H30ClN3O4 — CID 67420819
2-(diethylamino)ethyl 4-amino-2-chlorobenzoate;ethyl 4-aminobenzoate (PubChem CID 67420819) has the molecular formula C22H30ClN3O4 and a molecular weight of 435.95 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-amino-2-chlorobenzoate;ethyl 4-aminobenzoate.
| Compound Name | 2-(diethylamino)ethyl 4-amino-2-chlorobenzoate;ethyl 4-aminobenzoate |
|---|---|
| PubChem CID | 67420819 |
| Molecular Formula | C22H30ClN3O4 |
| Molecular Weight | 435.95 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 2-(diethylamino)ethyl 4-amino-2-chlorobenzoate;ethyl 4-aminobenzoate |
| SMILES | CCN(CC)CCOC(=O)c1ccc(N)cc1Cl.CCOC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C13H19ClN2O2.C9H11NO2/c1-3-16(4-2)7-8-18-13(17)11-6-5-10(15)9-12(11)14;1-2-12-9(11)7-3-5-8(10)6-4-7/h5-6,9H,3-4,7-8,15H2,1-2H3;3-6H,2,10H2,1H3 |
| InChIKey | OKMKBQIISLJJNU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.95 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|