C15H24ClNO2 — CID 138399963
2-(diethylamino)ethyl 3,5-dimethylbenzoate;hydrochloride (PubChem CID 138399963) has the molecular formula C15H24ClNO2 and a molecular weight of 285.82 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 3,5-dimethylbenzoate;hydrochloride.
| Compound Name | 2-(diethylamino)ethyl 3,5-dimethylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 138399963 |
| Molecular Formula | C15H24ClNO2 |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2-(diethylamino)ethyl 3,5-dimethylbenzoate;hydrochloride |
| SMILES | CCN(CC)CCOC(=O)c1cc(C)cc(C)c1.Cl |
| InChI | InChI=1S/C15H23NO2.ClH/c1-5-16(6-2)7-8-18-15(17)14-10-12(3)9-13(4)11-14;/h9-11H,5-8H2,1-4H3;1H |
| InChIKey | CORLSPRSJQXMTP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |