C21H30N4O6 — CID 70631894
2-(diethylamino)ethyl 4-aminobenzoate;2-hydroxybenzoic acid;urea (PubChem CID 70631894) has the molecular formula C21H30N4O6 and a molecular weight of 434.49 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-aminobenzoate;2-hydroxybenzoic acid;urea.
| Compound Name | 2-(diethylamino)ethyl 4-aminobenzoate;2-hydroxybenzoic acid;urea |
|---|---|
| PubChem CID | 70631894 |
| Molecular Formula | C21H30N4O6 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 2-(diethylamino)ethyl 4-aminobenzoate;2-hydroxybenzoic acid;urea |
| SMILES | CCN(CC)CCOC(=O)c1ccc(N)cc1.NC(N)=O.O=C(O)c1ccccc1O |
| InChI | InChI=1S/C13H20N2O2.C7H6O3.CH4N2O/c1-3-15(4-2)9-10-17-13(16)11-5-7-12(14)8-6-11;8-6-4-2-1-3-5(6)7(9)10;2-1(3)4/h5-8H,3-4,9-10,14H2,1-2H3;1-4,8H,(H,9,10);(H4,2,3,4) |
| InChIKey | HBVWJYAPCOTULV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 182.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|