About [2-[2-(diethylamino)ethoxycarbonyl]phenyl] 2-hydroxybenzoate;hydrochloride
[2-[2-(diethylamino)ethoxycarbonyl]phenyl] 2-hydroxybenzoate;hydrochloride (PubChem CID 168984736) has the molecular formula C20H24ClNO5
and a molecular weight of 393.87 g/mol. Its IUPAC name is [2-[2-(diethylamino)ethoxycarbonyl]phenyl] 2-hydroxybenzoate;hydrochloride.
Molecular Properties
| Compound Name | [2-[2-(diethylamino)ethoxycarbonyl]phenyl] 2-hydroxybenzoate;hydrochloride |
| PubChem CID | 168984736 |
| Molecular Formula | C20H24ClNO5 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | [2-[2-(diethylamino)ethoxycarbonyl]phenyl] 2-hydroxybenzoate;hydrochloride |
| SMILES | CCN(CC)CCOC(=O)c1ccccc1OC(=O)c1ccccc1O.Cl |
| InChI | InChI=1S/C20H23NO5.ClH/c1-3-21(4-2)13-14-25-19(23)16-10-6-8-12-18(16)26-20(24)15-9-5-7-11-17(15)22;/h5-12,22H,3-4,13-14H2,1-2H3;1H |
| InChIKey | UMQTXTBFPNQCPG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-[2-(diethylamino)ethoxycarbonyl]phenyl] 2-hydroxybenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(diethylamino)ethoxycarbonyl]phenyl] 2-hydroxybenzoate;hydrochloride?
The IUPAC name of [2-[2-(diethylamino)ethoxycarbonyl]phenyl] 2-hydroxybenzoate;hydrochloride (CID 168984736) is [2-[2-(diethylamino)ethoxycarbonyl]phenyl] 2-hydroxybenzoate;hydrochloride.
What is the SMILES notation for [2-[2-(diethylamino)ethoxycarbonyl]phenyl] 2-hydroxybenzoate;hydrochloride?
The canonical SMILES for [2-[2-(diethylamino)ethoxycarbonyl]phenyl] 2-hydroxybenzoate;hydrochloride is CCN(CC)CCOC(=O)c1ccccc1OC(=O)c1ccccc1O.Cl.
What is the InChIKey of [2-[2-(diethylamino)ethoxycarbonyl]phenyl] 2-hydroxybenzoate;hydrochloride?
The InChIKey is UMQTXTBFPNQCPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO5.ClH/c1-3-21(4-2)13-14-25-19(23)16-10-6-8-12-18(16)26-20(24)15-9-5-7-11-17(15)22;/h5-12,22H,3-4,13-14H2,1-2H3;1H.
What are the key properties of [2-[2-(diethylamino)ethoxycarbonyl]phenyl] 2-hydroxybenzoate;hydrochloride?
[2-[2-(diethylamino)ethoxycarbonyl]phenyl] 2-hydroxybenzoate;hydrochloride has a molecular weight of 393.87 g/mol, XLogP of 3.53, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(diethylamino)ethoxycarbonyl]phenyl] 2-hydroxybenzoate;hydrochloride is sourced from PubChem (CID 168984736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).