C20H33N3O4 — CID 71441917
bis[2-(diethylamino)ethyl] 3-aminobenzene-1,2-dicarboxylate (PubChem CID 71441917) has the molecular formula C20H33N3O4 and a molecular weight of 379.50 g/mol. Its IUPAC name is bis[2-(diethylamino)ethyl] 3-aminobenzene-1,2-dicarboxylate.
| Compound Name | bis[2-(diethylamino)ethyl] 3-aminobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 71441917 |
| Molecular Formula | C20H33N3O4 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | bis[2-(diethylamino)ethyl] 3-aminobenzene-1,2-dicarboxylate |
| SMILES | CCN(CC)CCOC(=O)c1cccc(N)c1C(=O)OCCN(CC)CC |
| InChI | InChI=1S/C20H33N3O4/c1-5-22(6-2)12-14-26-19(24)16-10-9-11-17(21)18(16)20(25)27-15-13-23(7-3)8-4/h9-11H,5-8,12-15,21H2,1-4H3 |
| InChIKey | CHHUAEPXZZSSOJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|