C20H32N2O4 — CID 24841866
2-O-[2-(diethylamino)ethyl] 1-O-hexyl 3-aminobenzene-1,2-dicarboxylate (PubChem CID 24841866) has the molecular formula C20H32N2O4 and a molecular weight of 364.49 g/mol. Its IUPAC name is 2-O-[2-(diethylamino)ethyl] 1-O-hexyl 3-aminobenzene-1,2-dicarboxylate.
| Compound Name | 2-O-[2-(diethylamino)ethyl] 1-O-hexyl 3-aminobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 24841866 |
| Molecular Formula | C20H32N2O4 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 2-O-[2-(diethylamino)ethyl] 1-O-hexyl 3-aminobenzene-1,2-dicarboxylate |
| SMILES | CCCCCCOC(=O)c1cccc(N)c1C(=O)OCCN(CC)CC |
| InChI | InChI=1S/C20H32N2O4/c1-4-7-8-9-14-25-19(23)16-11-10-12-17(21)18(16)20(24)26-15-13-22(5-2)6-3/h10-12H,4-9,13-15,21H2,1-3H3 |
| InChIKey | HMXBKPBVFQGWBE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|