C18H29BrN2O4 — CID 24841851
1-O-butyl 2-O-[2-(diethylamino)ethyl] 3-aminobenzene-1,2-dicarboxylate;hydrobromide (PubChem CID 24841851) has the molecular formula C18H29BrN2O4 and a molecular weight of 417.34 g/mol. Its IUPAC name is 1-O-butyl 2-O-[2-(diethylamino)ethyl] 3-aminobenzene-1,2-dicarboxylate;hydrobromide.
| Compound Name | 1-O-butyl 2-O-[2-(diethylamino)ethyl] 3-aminobenzene-1,2-dicarboxylate;hydrobromide |
|---|---|
| PubChem CID | 24841851 |
| Molecular Formula | C18H29BrN2O4 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 1-O-butyl 2-O-[2-(diethylamino)ethyl] 3-aminobenzene-1,2-dicarboxylate;hydrobromide |
| SMILES | Br.CCCCOC(=O)c1cccc(N)c1C(=O)OCCN(CC)CC |
| InChI | InChI=1S/C18H28N2O4.BrH/c1-4-7-12-23-17(21)14-9-8-10-15(19)16(14)18(22)24-13-11-20(5-2)6-3;/h8-10H,4-7,11-13,19H2,1-3H3;1H |
| InChIKey | ILMFGQXFVLLZDM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|