C22H37ClN2O4 — CID 156583221
1-O-[3-(dibutylamino)propyl] 2-O-propyl 3-aminobenzene-1,2-dicarboxylate;hydrochloride (PubChem CID 156583221) has the molecular formula C22H37ClN2O4 and a molecular weight of 429.00 g/mol. Its IUPAC name is 1-O-[3-(dibutylamino)propyl] 2-O-propyl 3-aminobenzene-1,2-dicarboxylate;hydrochloride.
| Compound Name | 1-O-[3-(dibutylamino)propyl] 2-O-propyl 3-aminobenzene-1,2-dicarboxylate;hydrochloride |
|---|---|
| PubChem CID | 156583221 |
| Molecular Formula | C22H37ClN2O4 |
| Molecular Weight | 429.00 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 1-O-[3-(dibutylamino)propyl] 2-O-propyl 3-aminobenzene-1,2-dicarboxylate;hydrochloride |
| SMILES | CCCCN(CCCC)CCCOC(=O)c1cccc(N)c1C(=O)OCCC.Cl |
| InChI | InChI=1S/C22H36N2O4.ClH/c1-4-7-13-24(14-8-5-2)15-10-17-28-21(25)18-11-9-12-19(23)20(18)22(26)27-16-6-3;/h9,11-12H,4-8,10,13-17,23H2,1-3H3;1H |
| InChIKey | OJLUVLCFALYXOB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.00 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|