C37H56N2O5 — CID 154120389
bis[3-(dibutylamino)propyl] 9H-xanthene-4,5-dicarboxylate (PubChem CID 154120389) has the molecular formula C37H56N2O5 and a molecular weight of 608.86 g/mol. Its IUPAC name is bis[3-(dibutylamino)propyl] 9H-xanthene-4,5-dicarboxylate.
| Compound Name | bis[3-(dibutylamino)propyl] 9H-xanthene-4,5-dicarboxylate |
|---|---|
| PubChem CID | 154120389 |
| Molecular Formula | C37H56N2O5 |
| Molecular Weight | 608.86 g/mol |
| Exact Mass | 608.42 |
| IUPAC Name | bis[3-(dibutylamino)propyl] 9H-xanthene-4,5-dicarboxylate |
| SMILES | CCCCN(CCCC)CCCOC(=O)c1cccc2c1Oc1c(cccc1C(=O)OCCCN(CCCC)CCCC)C2 |
| InChI | InChI=1S/C37H56N2O5/c1-5-9-21-38(22-10-6-2)25-15-27-42-36(40)32-19-13-17-30-29-31-18-14-20-33(35(31)44-34(30)32)37(41)43-28-16-26-39(23-11-7-3)24-12-8-4/h13-14,17-20H,5-12,15-16,21-29H2,1-4H3 |
| InChIKey | ZSUUJEZQDFIWAQ-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.86 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|