C36H64N2O4 — CID 139956457
bis[2-(dihexylamino)ethyl] benzene-1,2-dicarboxylate (PubChem CID 139956457) has the molecular formula C36H64N2O4 and a molecular weight of 588.92 g/mol. Its IUPAC name is bis[2-(dihexylamino)ethyl] benzene-1,2-dicarboxylate.
| Compound Name | bis[2-(dihexylamino)ethyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139956457 |
| Molecular Formula | C36H64N2O4 |
| Molecular Weight | 588.92 g/mol |
| Exact Mass | 588.49 |
| IUPAC Name | bis[2-(dihexylamino)ethyl] benzene-1,2-dicarboxylate |
| SMILES | CCCCCCN(CCCCCC)CCOC(=O)c1ccccc1C(=O)OCCN(CCCCCC)CCCCCC |
| InChI | InChI=1S/C36H64N2O4/c1-5-9-13-19-25-37(26-20-14-10-6-2)29-31-41-35(39)33-23-17-18-24-34(33)36(40)42-32-30-38(27-21-15-11-7-3)28-22-16-12-8-4/h17-18,23-24H,5-16,19-22,25-32H2,1-4H3 |
| InChIKey | DGCUBTPFGXGLKN-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.92 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|