C29H40N2O5 — CID 154124105
bis[3-(diethylamino)propyl] 9H-xanthene-1,8-dicarboxylate (PubChem CID 154124105) has the molecular formula C29H40N2O5 and a molecular weight of 496.65 g/mol. Its IUPAC name is bis[3-(diethylamino)propyl] 9H-xanthene-1,8-dicarboxylate.
| Compound Name | bis[3-(diethylamino)propyl] 9H-xanthene-1,8-dicarboxylate |
|---|---|
| PubChem CID | 154124105 |
| Molecular Formula | C29H40N2O5 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.29 |
| IUPAC Name | bis[3-(diethylamino)propyl] 9H-xanthene-1,8-dicarboxylate |
| SMILES | CCN(CC)CCCOC(=O)c1cccc2c1Cc1c(cccc1C(=O)OCCCN(CC)CC)O2 |
| InChI | InChI=1S/C29H40N2O5/c1-5-30(6-2)17-11-19-34-28(32)22-13-9-15-26-24(22)21-25-23(14-10-16-27(25)36-26)29(33)35-20-12-18-31(7-3)8-4/h9-10,13-16H,5-8,11-12,17-21H2,1-4H3 |
| InChIKey | VUOWIUNURICNFX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|