C17H28N2O2 — CID 174487618
2-(diethylamino)ethyl 2-amino-3-butylbenzoate (PubChem CID 174487618) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 2-amino-3-butylbenzoate.
| Compound Name | 2-(diethylamino)ethyl 2-amino-3-butylbenzoate |
|---|---|
| PubChem CID | 174487618 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 2-(diethylamino)ethyl 2-amino-3-butylbenzoate |
| SMILES | CCCCc1cccc(C(=O)OCCN(CC)CC)c1N |
| InChI | InChI=1S/C17H28N2O2/c1-4-7-9-14-10-8-11-15(16(14)18)17(20)21-13-12-19(5-2)6-3/h8,10-11H,4-7,9,12-13,18H2,1-3H3 |
| InChIKey | VRVWSJDFOLKAQX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|