About 2-(diethylamino)ethyl 2-(2-oxopropyl)benzoate;hydrochloride
2-(diethylamino)ethyl 2-(2-oxopropyl)benzoate;hydrochloride (PubChem CID 159121513) has the molecular formula C16H24ClNO3
and a molecular weight of 313.82 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 2-(2-oxopropyl)benzoate;hydrochloride.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 2-(2-oxopropyl)benzoate;hydrochloride |
| PubChem CID | 159121513 |
| Molecular Formula | C16H24ClNO3 |
| Molecular Weight | 313.82 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 2-(diethylamino)ethyl 2-(2-oxopropyl)benzoate;hydrochloride |
| SMILES | CCN(CC)CCOC(=O)c1ccccc1CC(C)=O.Cl |
| InChI | InChI=1S/C16H23NO3.ClH/c1-4-17(5-2)10-11-20-16(19)15-9-7-6-8-14(15)12-13(3)18;/h6-9H,4-5,10-12H2,1-3H3;1H |
| InChIKey | LYOVVUWXUHKYNJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.82 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(diethylamino)ethyl 2-(2-oxopropyl)benzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 2-(2-oxopropyl)benzoate;hydrochloride?
The IUPAC name of 2-(diethylamino)ethyl 2-(2-oxopropyl)benzoate;hydrochloride (CID 159121513) is 2-(diethylamino)ethyl 2-(2-oxopropyl)benzoate;hydrochloride.
What is the SMILES notation for 2-(diethylamino)ethyl 2-(2-oxopropyl)benzoate;hydrochloride?
The canonical SMILES for 2-(diethylamino)ethyl 2-(2-oxopropyl)benzoate;hydrochloride is CCN(CC)CCOC(=O)c1ccccc1CC(C)=O.Cl.
What is the InChIKey of 2-(diethylamino)ethyl 2-(2-oxopropyl)benzoate;hydrochloride?
The InChIKey is LYOVVUWXUHKYNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO3.ClH/c1-4-17(5-2)10-11-20-16(19)15-9-7-6-8-14(15)12-13(3)18;/h6-9H,4-5,10-12H2,1-3H3;1H.
What are the key properties of 2-(diethylamino)ethyl 2-(2-oxopropyl)benzoate;hydrochloride?
2-(diethylamino)ethyl 2-(2-oxopropyl)benzoate;hydrochloride has a molecular weight of 313.82 g/mol, XLogP of 2.74, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 2-(2-oxopropyl)benzoate;hydrochloride is sourced from PubChem (CID 159121513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).