C18H29BrN2O4 — CID 24841871
2-O-[2-(diethylamino)ethyl] 1-O-(2-methylpropyl) 3-aminobenzene-1,2-dicarboxylate;hydrobromide (PubChem CID 24841871) has the molecular formula C18H29BrN2O4 and a molecular weight of 417.34 g/mol. Its IUPAC name is 2-O-[2-(diethylamino)ethyl] 1-O-(2-methylpropyl) 3-aminobenzene-1,2-dicarboxylate;hydrobromide.
| Compound Name | 2-O-[2-(diethylamino)ethyl] 1-O-(2-methylpropyl) 3-aminobenzene-1,2-dicarboxylate;hydrobromide |
|---|---|
| PubChem CID | 24841871 |
| Molecular Formula | C18H29BrN2O4 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2-O-[2-(diethylamino)ethyl] 1-O-(2-methylpropyl) 3-aminobenzene-1,2-dicarboxylate;hydrobromide |
| SMILES | Br.CCN(CC)CCOC(=O)c1c(N)cccc1C(=O)OCC(C)C |
| InChI | InChI=1S/C18H28N2O4.BrH/c1-5-20(6-2)10-11-23-18(22)16-14(8-7-9-15(16)19)17(21)24-12-13(3)4;/h7-9,13H,5-6,10-12,19H2,1-4H3;1H |
| InChIKey | YEJJKTCTAWVWLK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|