C15H19ClO4 — CID 91720151
2-O-(2-chloropropyl) 1-O-(2-methylpropyl) benzene-1,2-dicarboxylate (PubChem CID 91720151) has the molecular formula C15H19ClO4 and a molecular weight of 298.77 g/mol. Its IUPAC name is 2-O-(2-chloropropyl) 1-O-(2-methylpropyl) benzene-1,2-dicarboxylate.
| Compound Name | 2-O-(2-chloropropyl) 1-O-(2-methylpropyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91720151 |
| Molecular Formula | C15H19ClO4 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-O-(2-chloropropyl) 1-O-(2-methylpropyl) benzene-1,2-dicarboxylate |
| SMILES | CC(C)COC(=O)c1ccccc1C(=O)OCC(C)Cl |
| InChI | InChI=1S/C15H19ClO4/c1-10(2)8-19-14(17)12-6-4-5-7-13(12)15(18)20-9-11(3)16/h4-7,10-11H,8-9H2,1-3H3 |
| InChIKey | IJGZXOXUGIBFIO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|