C40H44O8 — CID 123503031
tetrakis(2-methylpropyl) perylene-3,4,9,10-tetracarboxylate (PubChem CID 123503031) has the molecular formula C40H44O8 and a molecular weight of 652.78 g/mol. Its IUPAC name is tetrakis(2-methylpropyl) perylene-3,4,9,10-tetracarboxylate.
| Compound Name | tetrakis(2-methylpropyl) perylene-3,4,9,10-tetracarboxylate |
|---|---|
| PubChem CID | 123503031 |
| Molecular Formula | C40H44O8 |
| Molecular Weight | 652.78 g/mol |
| Exact Mass | 652.30 |
| IUPAC Name | tetrakis(2-methylpropyl) perylene-3,4,9,10-tetracarboxylate |
| SMILES | CC(C)COC(=O)c1ccc2c3ccc(C(=O)OCC(C)C)c4c(C(=O)OCC(C)C)ccc(c5ccc(C(=O)OCC(C)C)c1c25)c43 |
| InChI | InChI=1S/C40H44O8/c1-21(2)17-45-37(41)29-13-9-25-27-11-15-31(39(43)47-19-23(5)6)36-32(40(44)48-20-24(7)8)16-12-28(34(27)36)26-10-14-30(35(29)33(25)26)38(42)46-18-22(3)4/h9-16,21-24H,17-20H2,1-8H3 |
| InChIKey | XKLQFXHXHYRPJI-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.78 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|