C16H20Br2O4 — CID 23502142
bis(2-methylpropyl) 4,5-dibromobenzene-1,2-dicarboxylate (PubChem CID 23502142) has the molecular formula C16H20Br2O4 and a molecular weight of 436.14 g/mol. Its IUPAC name is bis(2-methylpropyl) 4,5-dibromobenzene-1,2-dicarboxylate.
| Compound Name | bis(2-methylpropyl) 4,5-dibromobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 23502142 |
| Molecular Formula | C16H20Br2O4 |
| Molecular Weight | 436.14 g/mol |
| Exact Mass | 433.97 |
| IUPAC Name | bis(2-methylpropyl) 4,5-dibromobenzene-1,2-dicarboxylate |
| SMILES | CC(C)COC(=O)c1cc(Br)c(Br)cc1C(=O)OCC(C)C |
| InChI | InChI=1S/C16H20Br2O4/c1-9(2)7-21-15(19)11-5-13(17)14(18)6-12(11)16(20)22-8-10(3)4/h5-6,9-10H,7-8H2,1-4H3 |
| InChIKey | WOLDPZMQCZKLKB-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.14 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |