About 2-methylpropyl 2-amino-4-bromobenzoate
2-methylpropyl 2-amino-4-bromobenzoate (PubChem CID 61277458) has the molecular formula C11H14BrNO2
and a molecular weight of 272.14 g/mol. Its IUPAC name is 2-methylpropyl 2-amino-4-bromobenzoate.
Molecular Properties
| Compound Name | 2-methylpropyl 2-amino-4-bromobenzoate |
| PubChem CID | 61277458 |
| Molecular Formula | C11H14BrNO2 |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 2-methylpropyl 2-amino-4-bromobenzoate |
| SMILES | CC(C)COC(=O)c1ccc(Br)cc1N |
| InChI | InChI=1S/C11H14BrNO2/c1-7(2)6-15-11(14)9-4-3-8(12)5-10(9)13/h3-5,7H,6,13H2,1-2H3 |
| InChIKey | GUMVLZPZJPCPQY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl 2-amino-4-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 2-amino-4-bromobenzoate?
The IUPAC name of 2-methylpropyl 2-amino-4-bromobenzoate (CID 61277458) is 2-methylpropyl 2-amino-4-bromobenzoate.
What is the SMILES notation for 2-methylpropyl 2-amino-4-bromobenzoate?
The canonical SMILES for 2-methylpropyl 2-amino-4-bromobenzoate is CC(C)COC(=O)c1ccc(Br)cc1N.
What is the InChIKey of 2-methylpropyl 2-amino-4-bromobenzoate?
The InChIKey is GUMVLZPZJPCPQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BrNO2/c1-7(2)6-15-11(14)9-4-3-8(12)5-10(9)13/h3-5,7H,6,13H2,1-2H3.
What are the key properties of 2-methylpropyl 2-amino-4-bromobenzoate?
2-methylpropyl 2-amino-4-bromobenzoate has a molecular weight of 272.14 g/mol, XLogP of 2.84, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 2-amino-4-bromobenzoate is sourced from PubChem (CID 61277458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).