About 1-ethoxypropan-2-yl 2-amino-4-bromobenzoate
1-ethoxypropan-2-yl 2-amino-4-bromobenzoate (PubChem CID 103488997) has the molecular formula C12H16BrNO3
and a molecular weight of 302.17 g/mol. Its IUPAC name is 1-ethoxypropan-2-yl 2-amino-4-bromobenzoate.
Molecular Properties
| Compound Name | 1-ethoxypropan-2-yl 2-amino-4-bromobenzoate |
| PubChem CID | 103488997 |
| Molecular Formula | C12H16BrNO3 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 1-ethoxypropan-2-yl 2-amino-4-bromobenzoate |
| SMILES | CCOCC(C)OC(=O)c1ccc(Br)cc1N |
| InChI | InChI=1S/C12H16BrNO3/c1-3-16-7-8(2)17-12(15)10-5-4-9(13)6-11(10)14/h4-6,8H,3,7,14H2,1-2H3 |
| InChIKey | DTNQTWMULIRMNZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxypropan-2-yl 2-amino-4-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxypropan-2-yl 2-amino-4-bromobenzoate?
The IUPAC name of 1-ethoxypropan-2-yl 2-amino-4-bromobenzoate (CID 103488997) is 1-ethoxypropan-2-yl 2-amino-4-bromobenzoate.
What is the SMILES notation for 1-ethoxypropan-2-yl 2-amino-4-bromobenzoate?
The canonical SMILES for 1-ethoxypropan-2-yl 2-amino-4-bromobenzoate is CCOCC(C)OC(=O)c1ccc(Br)cc1N.
What is the InChIKey of 1-ethoxypropan-2-yl 2-amino-4-bromobenzoate?
The InChIKey is DTNQTWMULIRMNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16BrNO3/c1-3-16-7-8(2)17-12(15)10-5-4-9(13)6-11(10)14/h4-6,8H,3,7,14H2,1-2H3.
What are the key properties of 1-ethoxypropan-2-yl 2-amino-4-bromobenzoate?
1-ethoxypropan-2-yl 2-amino-4-bromobenzoate has a molecular weight of 302.17 g/mol, XLogP of 2.61, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxypropan-2-yl 2-amino-4-bromobenzoate is sourced from PubChem (CID 103488997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).